C26H40N4O7 — CID 158460359
[(2R,5R)-2-(deuteriomethyl)-5-[5-[(E)-3-(octylamino)-3-oxoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]oxolan-3-yl] 4-(ethylamino)-4-oxobutanoate (PubChem CID 158460359) has the molecular formula C26H40N4O7 and a molecular weight of 521.63 g/mol. Its IUPAC name is [(2R,5R)-2-(deuteriomethyl)-5-[5-[(E)-3-(octylamino)-3-oxoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]oxolan-3-yl] 4-(ethylamino)-4-oxobutanoate.
| Compound Name | [(2R,5R)-2-(deuteriomethyl)-5-[5-[(E)-3-(octylamino)-3-oxoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]oxolan-3-yl] 4-(ethylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 158460359 |
| Molecular Formula | C26H40N4O7 |
| Molecular Weight | 521.63 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | [(2R,5R)-2-(deuteriomethyl)-5-[5-[(E)-3-(octylamino)-3-oxoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]oxolan-3-yl] 4-(ethylamino)-4-oxobutanoate |
| SMILES | [2H]C[C@H]1O[C@@H](n2cc(/C=C/C(=O)NCCCCCCCC)c(=O)[nH]c2=O)CC1OC(=O)CCC(=O)NCC |
| InChI | InChI=1S/C26H40N4O7/c1-4-6-7-8-9-10-15-28-22(32)12-11-19-17-30(26(35)29-25(19)34)23-16-20(18(3)36-23)37-24(33)14-13-21(31)27-5-2/h11-12,17-18,20,23H,4-10,13-16H2,1-3H3,(H,27,31)(H,28,32)(H,29,34,35)/b12-11+/t18-,20?,23-/m1/s1/i3D |
| InChIKey | AKNDFKCNEKGVBP-FAMHNDCHSA-N |
| XLogP | 2.16 |
| TPSA | 148.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.63 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|