About 1-[2-(methoxymethyl)-1,3-dioxolan-4-yl]-4,6-dimethylbenzimidazole
1-[2-(methoxymethyl)-1,3-dioxolan-4-yl]-4,6-dimethylbenzimidazole (PubChem CID 58521325) has the molecular formula C14H18N2O3
and a molecular weight of 262.31 g/mol. Its IUPAC name is 1-[2-(methoxymethyl)-1,3-dioxolan-4-yl]-4,6-dimethylbenzimidazole.
Molecular Properties
| Compound Name | 1-[2-(methoxymethyl)-1,3-dioxolan-4-yl]-4,6-dimethylbenzimidazole |
| PubChem CID | 58521325 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1-[2-(methoxymethyl)-1,3-dioxolan-4-yl]-4,6-dimethylbenzimidazole |
| SMILES | COCC1OCC(n2cnc3c(C)cc(C)cc32)O1 |
| InChI | InChI=1S/C14H18N2O3/c1-9-4-10(2)14-11(5-9)16(8-15-14)12-6-18-13(19-12)7-17-3/h4-5,8,12-13H,6-7H2,1-3H3 |
| InChIKey | LXMJIDLDVVRHCP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-(methoxymethyl)-1,3-dioxolan-4-yl]-4,6-dimethylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(methoxymethyl)-1,3-dioxolan-4-yl]-4,6-dimethylbenzimidazole?
The IUPAC name of 1-[2-(methoxymethyl)-1,3-dioxolan-4-yl]-4,6-dimethylbenzimidazole (CID 58521325) is 1-[2-(methoxymethyl)-1,3-dioxolan-4-yl]-4,6-dimethylbenzimidazole.
What is the SMILES notation for 1-[2-(methoxymethyl)-1,3-dioxolan-4-yl]-4,6-dimethylbenzimidazole?
The canonical SMILES for 1-[2-(methoxymethyl)-1,3-dioxolan-4-yl]-4,6-dimethylbenzimidazole is COCC1OCC(n2cnc3c(C)cc(C)cc32)O1.
What is the InChIKey of 1-[2-(methoxymethyl)-1,3-dioxolan-4-yl]-4,6-dimethylbenzimidazole?
The InChIKey is LXMJIDLDVVRHCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O3/c1-9-4-10(2)14-11(5-9)16(8-15-14)12-6-18-13(19-12)7-17-3/h4-5,8,12-13H,6-7H2,1-3H3.
What are the key properties of 1-[2-(methoxymethyl)-1,3-dioxolan-4-yl]-4,6-dimethylbenzimidazole?
1-[2-(methoxymethyl)-1,3-dioxolan-4-yl]-4,6-dimethylbenzimidazole has a molecular weight of 262.31 g/mol, XLogP of 2.17, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(methoxymethyl)-1,3-dioxolan-4-yl]-4,6-dimethylbenzimidazole is sourced from PubChem (CID 58521325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).