C10H12N4O4 — CID 10037827
[(2S,4R)-4-(6-methoxypurin-9-yl)-1,3-dioxolan-2-yl]methanol (PubChem CID 10037827) has the molecular formula C10H12N4O4 and a molecular weight of 252.23 g/mol. Its IUPAC name is [(2S,4R)-4-(6-methoxypurin-9-yl)-1,3-dioxolan-2-yl]methanol.
| Compound Name | [(2S,4R)-4-(6-methoxypurin-9-yl)-1,3-dioxolan-2-yl]methanol |
|---|---|
| PubChem CID | 10037827 |
| Molecular Formula | C10H12N4O4 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | [(2S,4R)-4-(6-methoxypurin-9-yl)-1,3-dioxolan-2-yl]methanol |
| SMILES | COc1ncnc2c1ncn2[C@H]1CO[C@H](CO)O1 |
| InChI | InChI=1S/C10H12N4O4/c1-16-10-8-9(11-4-12-10)14(5-13-8)6-3-17-7(2-15)18-6/h4-7,15H,2-3H2,1H3/t6-,7+/m1/s1 |
| InChIKey | BCHSZIJLJINNKF-RQJHMYQMSA-N |
| XLogP | -0.30 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |