C20H24N6O7 — CID 58104966
2-amino-9-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-[2-(2-nitrophenyl)propoxymethyl]purin-6-one (PubChem CID 58104966) has the molecular formula C20H24N6O7 and a molecular weight of 460.45 g/mol. Its IUPAC name is 2-amino-9-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-[2-(2-nitrophenyl)propoxymethyl]purin-6-one.
| Compound Name | 2-amino-9-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-[2-(2-nitrophenyl)propoxymethyl]purin-6-one |
|---|---|
| PubChem CID | 58104966 |
| Molecular Formula | C20H24N6O7 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 2-amino-9-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-[2-(2-nitrophenyl)propoxymethyl]purin-6-one |
| SMILES | CC(COCn1c(N)nc2c(ncn2[C@H]2C[C@@H](O)[C@@H](CO)O2)c1=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H24N6O7/c1-11(12-4-2-3-5-13(12)26(30)31)8-32-10-25-19(29)17-18(23-20(25)21)24(9-22-17)16-6-14(28)15(7-27)33-16/h2-5,9,11,14-16,27-28H,6-8,10H2,1H3,(H2,21,23)/t11?,14-,15-,16-/m1/s1 |
| InChIKey | WFLIBHVPKVNPNH-JERNAADCSA-N |
| XLogP | 0.50 |
| TPSA | 180.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|