C21H28N6O6 — CID 89445365
(2R,5R)-5-[6-amino-7-[[2-methyl-3-(2-nitrophenyl)propoxy]methyl]-8H-purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 89445365) has the molecular formula C21H28N6O6 and a molecular weight of 460.49 g/mol. Its IUPAC name is (2R,5R)-5-[6-amino-7-[[2-methyl-3-(2-nitrophenyl)propoxy]methyl]-8H-purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,5R)-5-[6-amino-7-[[2-methyl-3-(2-nitrophenyl)propoxy]methyl]-8H-purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 89445365 |
| Molecular Formula | C21H28N6O6 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | (2R,5R)-5-[6-amino-7-[[2-methyl-3-(2-nitrophenyl)propoxy]methyl]-8H-purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | CC(COCN1CN([C@H]2CC(O)[C@@H](CO)O2)c2ncnc(N)c21)Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H28N6O6/c1-13(6-14-4-2-3-5-15(14)27(30)31)9-32-12-25-11-26(18-7-16(29)17(8-28)33-18)21-19(25)20(22)23-10-24-21/h2-5,10,13,16-18,28-29H,6-9,11-12H2,1H3,(H2,22,23,24)/t13?,16?,17-,18-/m1/s1 |
| InChIKey | IDZRXNVDHAZWLA-BLYBZDDLSA-N |
| XLogP | 0.87 |
| TPSA | 160.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|