C18H20N6O5 — CID 66830952
(2R,3S,5S)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-5-[1-(2-nitrophenyl)ethyl]oxolan-3-ol (PubChem CID 66830952) has the molecular formula C18H20N6O5 and a molecular weight of 400.40 g/mol. Its IUPAC name is (2R,3S,5S)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-5-[1-(2-nitrophenyl)ethyl]oxolan-3-ol.
| Compound Name | (2R,3S,5S)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-5-[1-(2-nitrophenyl)ethyl]oxolan-3-ol |
|---|---|
| PubChem CID | 66830952 |
| Molecular Formula | C18H20N6O5 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (2R,3S,5S)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-5-[1-(2-nitrophenyl)ethyl]oxolan-3-ol |
| SMILES | CC(c1ccccc1[N+](=O)[O-])[C@]1(n2cnc3c(N)ncnc32)C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C18H20N6O5/c1-10(11-4-2-3-5-12(11)24(27)28)18(6-13(26)14(7-25)29-18)23-9-22-15-16(19)20-8-21-17(15)23/h2-5,8-10,13-14,25-26H,6-7H2,1H3,(H2,19,20,21)/t10?,13-,14+,18-/m0/s1 |
| InChIKey | AIQBHZGPPYYBBT-UVGIOEAGSA-N |
| XLogP | 0.92 |
| TPSA | 162.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|