C17H16N6O8 — CID 153400873
(4-nitrophenyl) (2S,3R,4S,5R)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolane-2-carboxylate (PubChem CID 153400873) has the molecular formula C17H16N6O8 and a molecular weight of 432.35 g/mol. Its IUPAC name is (4-nitrophenyl) (2S,3R,4S,5R)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolane-2-carboxylate.
| Compound Name | (4-nitrophenyl) (2S,3R,4S,5R)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolane-2-carboxylate |
|---|---|
| PubChem CID | 153400873 |
| Molecular Formula | C17H16N6O8 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | (4-nitrophenyl) (2S,3R,4S,5R)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolane-2-carboxylate |
| SMILES | Nc1ncnc2c1ncn2[C@]1(C(=O)Oc2ccc([N+](=O)[O-])cc2)O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H16N6O8/c18-14-11-15(20-6-19-14)22(7-21-11)17(13(26)12(25)10(5-24)31-17)16(27)30-9-3-1-8(2-4-9)23(28)29/h1-4,6-7,10,12-13,24-26H,5H2,(H2,18,19,20)/t10-,12-,13-,17+/m1/s1 |
| InChIKey | YZGBULWFDDABII-MDCUPZMDSA-N |
| XLogP | -1.31 |
| TPSA | 208.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|