C16H27N5O3Si — CID 67780261
(2R,3S,5S)-5-(6-aminopurin-9-yl)-5-[butyl(dimethyl)silyl]-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 67780261) has the molecular formula C16H27N5O3Si and a molecular weight of 365.51 g/mol. Its IUPAC name is (2R,3S,5S)-5-(6-aminopurin-9-yl)-5-[butyl(dimethyl)silyl]-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5S)-5-(6-aminopurin-9-yl)-5-[butyl(dimethyl)silyl]-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 67780261 |
| Molecular Formula | C16H27N5O3Si |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | (2R,3S,5S)-5-(6-aminopurin-9-yl)-5-[butyl(dimethyl)silyl]-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | CCCC[Si](C)(C)[C@]1(n2cnc3c(N)ncnc32)C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C16H27N5O3Si/c1-4-5-6-25(2,3)16(7-11(23)12(8-22)24-16)21-10-20-13-14(17)18-9-19-15(13)21/h9-12,22-23H,4-8H2,1-3H3,(H2,17,18,19)/t11-,12+,16-/m0/s1 |
| InChIKey | SZYLGMQGOPPIKZ-OZVIIMIRSA-N |
| XLogP | 1.25 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|