C10H12ClN5O3 — CID 145088486
(2R,3R,5S)-2-(6-aminopurin-9-yl)-2-chloro-5-(hydroxymethyl)oxolan-3-ol (PubChem CID 145088486) has the molecular formula C10H12ClN5O3 and a molecular weight of 285.69 g/mol. Its IUPAC name is (2R,3R,5S)-2-(6-aminopurin-9-yl)-2-chloro-5-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,5S)-2-(6-aminopurin-9-yl)-2-chloro-5-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 145088486 |
| Molecular Formula | C10H12ClN5O3 |
| Molecular Weight | 285.69 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | (2R,3R,5S)-2-(6-aminopurin-9-yl)-2-chloro-5-(hydroxymethyl)oxolan-3-ol |
| SMILES | Nc1ncnc2c1ncn2[C@@]1(Cl)O[C@H](CO)C[C@H]1O |
| InChI | InChI=1S/C10H12ClN5O3/c11-10(6(18)1-5(2-17)19-10)16-4-15-7-8(12)13-3-14-9(7)16/h3-6,17-18H,1-2H2,(H2,12,13,14)/t5-,6+,10+/m0/s1 |
| InChIKey | LANFPUYLRLWSDF-BAJZRUMYSA-N |
| XLogP | -0.60 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.69 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|