C12H16FN2O14P3 — CID 123334891
[[4-ethynyl-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxy-2-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 123334891) has the molecular formula C12H16FN2O14P3 and a molecular weight of 524.18 g/mol. Its IUPAC name is [[4-ethynyl-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxy-2-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[4-ethynyl-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxy-2-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 123334891 |
| Molecular Formula | C12H16FN2O14P3 |
| Molecular Weight | 524.18 g/mol |
| Exact Mass | 523.98 |
| IUPAC Name | [[4-ethynyl-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxy-2-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#CC1C(n2cc(F)c(=O)[nH]c2=O)OC(C)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C1O |
| InChI | InChI=1S/C12H16FN2O14P3/c1-3-6-8(16)12(2,27-10(6)15-4-7(13)9(17)14-11(15)18)5-26-31(22,23)29-32(24,25)28-30(19,20)21/h1,4,6,8,10,16H,5H2,2H3,(H,22,23)(H,24,25)(H,14,17,18)(H2,19,20,21) |
| InChIKey | OZKPNOSVVZMSGI-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 244.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.18 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|