C26H30N7O9P — CID 45270005
benzyl 2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate (PubChem CID 45270005) has the molecular formula C26H30N7O9P and a molecular weight of 615.54 g/mol. Its IUPAC name is benzyl 2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate.
| Compound Name | benzyl 2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 45270005 |
| Molecular Formula | C26H30N7O9P |
| Molecular Weight | 615.54 g/mol |
| Exact Mass | 615.18 |
| IUPAC Name | benzyl 2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate |
| SMILES | CC(C)(NP(=O)(OC[C@@]1(N=[N+]=[N-])O[C@@H](n2ccc(N)nc2=O)[C@H](O)[C@@H]1O)Oc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H30N7O9P/c1-25(2,23(36)39-15-17-9-5-3-6-10-17)31-43(38,42-18-11-7-4-8-12-18)40-16-26(30-32-28)21(35)20(34)22(41-26)33-14-13-19(27)29-24(33)37/h3-14,20-22,34-35H,15-16H2,1-2H3,(H,31,38)(H2,27,29,37)/t20-,21+,22-,26-,43?/m1/s1 |
| InChIKey | BWVFQPGSYUEAQD-LRVNSFJJSA-N |
| XLogP | 2.40 |
| TPSA | 233.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.54 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|