C23H30ClN6O10P — CID 90714924
ethyl (2S)-2-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]-4-methylpentanoate (PubChem CID 90714924) has the molecular formula C23H30ClN6O10P and a molecular weight of 616.95 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]-4-methylpentanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 90714924 |
| Molecular Formula | C23H30ClN6O10P |
| Molecular Weight | 616.95 g/mol |
| Exact Mass | 616.14 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]-4-methylpentanoate |
| SMILES | CCOC(=O)[C@H](CC(C)C)NP(=O)(OC[C@@]1(N=[N+]=[N-])O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H30ClN6O10P/c1-4-37-21(34)16(11-13(2)3)27-41(36,40-15-7-5-14(24)6-8-15)38-12-23(28-29-25)19(33)18(32)20(39-23)30-10-9-17(31)26-22(30)35/h5-10,13,16,18-20,32-33H,4,11-12H2,1-3H3,(H,27,36)(H,26,31,35)/t16-,18+,19-,20+,23+,41?/m0/s1 |
| InChIKey | XVENGYOVOBDANC-YITLGEGRSA-N |
| XLogP | 2.22 |
| TPSA | 227.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.95 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|