C23H30N3O9PS — CID 118221453
[(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-[[[[(2S)-1-oxo-1-propan-2-ylsulfanylpropan-2-yl]amino]-phenoxyphosphoryl]oxymethyl]oxolan-3-yl] acetate (PubChem CID 118221453) has the molecular formula C23H30N3O9PS and a molecular weight of 555.55 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-[[[[(2S)-1-oxo-1-propan-2-ylsulfanylpropan-2-yl]amino]-phenoxyphosphoryl]oxymethyl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-[[[[(2S)-1-oxo-1-propan-2-ylsulfanylpropan-2-yl]amino]-phenoxyphosphoryl]oxymethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 118221453 |
| Molecular Formula | C23H30N3O9PS |
| Molecular Weight | 555.55 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | [(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-[[[[(2S)-1-oxo-1-propan-2-ylsulfanylpropan-2-yl]amino]-phenoxyphosphoryl]oxymethyl]oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1CO[P@@](=O)(N[C@@H](C)C(=O)SC(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C23H30N3O9PS/c1-14(2)37-22(29)15(3)25-36(31,35-17-8-6-5-7-9-17)32-13-19-18(33-16(4)27)12-21(34-19)26-11-10-20(28)24-23(26)30/h5-11,14-15,18-19,21H,12-13H2,1-4H3,(H,25,31)(H,24,28,30)/t15-,18-,19+,21+,36-/m0/s1 |
| InChIKey | UXKZZRWEJBCESI-OKWKWBJSSA-N |
| XLogP | 2.61 |
| TPSA | 155.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.55 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|