C23H31FN3O10P — CID 174216103
[(2R,3S)-2-[[(1,1-dimethoxypropan-2-ylamino)-phenoxyphosphoryl]oxymethyl]-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] propanoate (PubChem CID 174216103) has the molecular formula C23H31FN3O10P and a molecular weight of 559.48 g/mol. Its IUPAC name is [(2R,3S)-2-[[(1,1-dimethoxypropan-2-ylamino)-phenoxyphosphoryl]oxymethyl]-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] propanoate.
| Compound Name | [(2R,3S)-2-[[(1,1-dimethoxypropan-2-ylamino)-phenoxyphosphoryl]oxymethyl]-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] propanoate |
|---|---|
| PubChem CID | 174216103 |
| Molecular Formula | C23H31FN3O10P |
| Molecular Weight | 559.48 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | [(2R,3S)-2-[[(1,1-dimethoxypropan-2-ylamino)-phenoxyphosphoryl]oxymethyl]-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1CC(n2cc(F)c(=O)[nH]c2=O)O[C@@H]1COP(=O)(NC(C)C(OC)OC)Oc1ccccc1 |
| InChI | InChI=1S/C23H31FN3O10P/c1-5-20(28)36-17-11-19(27-12-16(24)21(29)25-23(27)30)35-18(17)13-34-38(31,26-14(2)22(32-3)33-4)37-15-9-7-6-8-10-15/h6-10,12,14,17-19,22H,5,11,13H2,1-4H3,(H,26,31)(H,25,29,30)/t14?,17-,18+,19?,38?/m0/s1 |
| InChIKey | LMYCPJTXQMNZAR-CCGIWQEZSA-N |
| XLogP | 2.09 |
| TPSA | 156.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|