C22H29FN3O10P — CID 142622633
[(2R,3S,5R)-2-[[(2,2-dimethoxyethylamino)-phenoxyphosphoryl]oxymethyl]-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] propanoate (PubChem CID 142622633) has the molecular formula C22H29FN3O10P and a molecular weight of 545.46 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[[(2,2-dimethoxyethylamino)-phenoxyphosphoryl]oxymethyl]-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] propanoate.
| Compound Name | [(2R,3S,5R)-2-[[(2,2-dimethoxyethylamino)-phenoxyphosphoryl]oxymethyl]-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] propanoate |
|---|---|
| PubChem CID | 142622633 |
| Molecular Formula | C22H29FN3O10P |
| Molecular Weight | 545.46 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | [(2R,3S,5R)-2-[[(2,2-dimethoxyethylamino)-phenoxyphosphoryl]oxymethyl]-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1C[C@H](n2cc(F)c(=O)[nH]c2=O)O[C@@H]1COP(=O)(NCC(OC)OC)Oc1ccccc1 |
| InChI | InChI=1S/C22H29FN3O10P/c1-4-19(27)35-16-10-18(26-12-15(23)21(28)25-22(26)29)34-17(16)13-33-37(30,24-11-20(31-2)32-3)36-14-8-6-5-7-9-14/h5-9,12,16-18,20H,4,10-11,13H2,1-3H3,(H,24,30)(H,25,28,29)/t16-,17+,18+,37?/m0/s1 |
| InChIKey | CUDOJGJNNFVQPT-QYXZXOAVSA-N |
| XLogP | 1.70 |
| TPSA | 156.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|