C25H35FN3O10P — CID 174216056
[(2R,3S)-2-[[(1,1-dimethoxypropan-2-ylamino)-(3-ethylphenoxy)phosphoryl]oxymethyl]-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] propanoate (PubChem CID 174216056) has the molecular formula C25H35FN3O10P and a molecular weight of 587.54 g/mol. Its IUPAC name is [(2R,3S)-2-[[(1,1-dimethoxypropan-2-ylamino)-(3-ethylphenoxy)phosphoryl]oxymethyl]-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] propanoate.
| Compound Name | [(2R,3S)-2-[[(1,1-dimethoxypropan-2-ylamino)-(3-ethylphenoxy)phosphoryl]oxymethyl]-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] propanoate |
|---|---|
| PubChem CID | 174216056 |
| Molecular Formula | C25H35FN3O10P |
| Molecular Weight | 587.54 g/mol |
| Exact Mass | 587.20 |
| IUPAC Name | [(2R,3S)-2-[[(1,1-dimethoxypropan-2-ylamino)-(3-ethylphenoxy)phosphoryl]oxymethyl]-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1CC(n2cc(F)c(=O)[nH]c2=O)O[C@@H]1COP(=O)(NC(C)C(OC)OC)Oc1cccc(CC)c1 |
| InChI | InChI=1S/C25H35FN3O10P/c1-6-16-9-8-10-17(11-16)39-40(33,28-15(3)24(34-4)35-5)36-14-20-19(38-22(30)7-2)12-21(37-20)29-13-18(26)23(31)27-25(29)32/h8-11,13,15,19-21,24H,6-7,12,14H2,1-5H3,(H,28,33)(H,27,31,32)/t15?,19-,20+,21?,40?/m0/s1 |
| InChIKey | GWDCELCGBSNMLX-RRBZEDNZSA-N |
| XLogP | 2.65 |
| TPSA | 156.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.54 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|