C17H20Cl6FN2O9P — CID 10416927
[(2R,3S,5R)-2-[bis(2,2,2-trichloroethoxy)phosphoryloxymethyl]-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] butanoate (PubChem CID 10416927) has the molecular formula C17H20Cl6FN2O9P and a molecular weight of 659.04 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[bis(2,2,2-trichloroethoxy)phosphoryloxymethyl]-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] butanoate.
| Compound Name | [(2R,3S,5R)-2-[bis(2,2,2-trichloroethoxy)phosphoryloxymethyl]-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] butanoate |
|---|---|
| PubChem CID | 10416927 |
| Molecular Formula | C17H20Cl6FN2O9P |
| Molecular Weight | 659.04 g/mol |
| Exact Mass | 655.90 |
| IUPAC Name | [(2R,3S,5R)-2-[bis(2,2,2-trichloroethoxy)phosphoryloxymethyl]-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] butanoate |
| SMILES | CCCC(=O)O[C@H]1C[C@H](n2cc(F)c(=O)[nH]c2=O)O[C@@H]1COP(=O)(OCC(Cl)(Cl)Cl)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H20Cl6FN2O9P/c1-2-3-13(27)35-10-4-12(26-5-9(24)14(28)25-15(26)29)34-11(10)6-31-36(30,32-7-16(18,19)20)33-8-17(21,22)23/h5,10-12H,2-4,6-8H2,1H3,(H,25,28,29)/t10-,11+,12+/m0/s1 |
| InChIKey | MVHMLFUBYIRNJA-QJPTWQEYSA-N |
| XLogP | 4.57 |
| TPSA | 135.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.04 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|