C18H20ClFN3O7P — CID 127034524
1-[(2R,4S,5R)-5-[[(4-chlorophenoxy)-(prop-2-enylamino)phosphoryl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 127034524) has the molecular formula C18H20ClFN3O7P and a molecular weight of 475.80 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-[[(4-chlorophenoxy)-(prop-2-enylamino)phosphoryl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-5-[[(4-chlorophenoxy)-(prop-2-enylamino)phosphoryl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 127034524 |
| Molecular Formula | C18H20ClFN3O7P |
| Molecular Weight | 475.80 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | 1-[(2R,4S,5R)-5-[[(4-chlorophenoxy)-(prop-2-enylamino)phosphoryl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | C=CCNP(=O)(OC[C@H]1O[C@@H](n2cc(F)c(=O)[nH]c2=O)C[C@@H]1O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H20ClFN3O7P/c1-2-7-21-31(27,30-12-5-3-11(19)4-6-12)28-10-15-14(24)8-16(29-15)23-9-13(20)17(25)22-18(23)26/h2-6,9,14-16,24H,1,7-8,10H2,(H,21,27)(H,22,25,26)/t14-,15+,16+,31?/m0/s1 |
| InChIKey | OSMLHYPMCKNOBP-AXWAUASUSA-N |
| XLogP | 1.96 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.80 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|