C20H27FN3O9P — CID 174063541
methyl (2S)-2-[[[(2R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyphosphoryl]amino]propanoate (PubChem CID 174063541) has the molecular formula C20H27FN3O9P and a molecular weight of 503.42 g/mol. Its IUPAC name is methyl (2S)-2-[[[(2R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyphosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(2R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 174063541 |
| Molecular Formula | C20H27FN3O9P |
| Molecular Weight | 503.42 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | methyl (2S)-2-[[[(2R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyphosphoryl]amino]propanoate |
| SMILES | C=C/C=C\C(=C/C)OP(=O)(N[C@@H](C)C(=O)OC)OC[C@H]1O[C@@H](n2cc(F)c(=O)[nH]c2=O)CC1O |
| InChI | InChI=1S/C20H27FN3O9P/c1-5-7-8-13(6-2)33-34(29,23-12(3)19(27)30-4)31-11-16-15(25)9-17(32-16)24-10-14(21)18(26)22-20(24)28/h5-8,10,12,15-17,25H,1,9,11H2,2-4H3,(H,23,29)(H,22,26,28)/b8-7-,13-6+/t12-,15?,16+,17+,34?/m0/s1 |
| InChIKey | KUOLYCFAKLDCQX-QDPWRVLASA-N |
| XLogP | 1.26 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.42 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|