C20H24N2O5 — CID 11574291
1-[(1R,2R,3R,4R,5S,6R)-3-hydroxy-5-(hydroxymethyl)-6-phenylmethoxy-2-bicyclo[2.2.1]heptanyl]-5-methylpyrimidine-2,4-dione (PubChem CID 11574291) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 1-[(1R,2R,3R,4R,5S,6R)-3-hydroxy-5-(hydroxymethyl)-6-phenylmethoxy-2-bicyclo[2.2.1]heptanyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(1R,2R,3R,4R,5S,6R)-3-hydroxy-5-(hydroxymethyl)-6-phenylmethoxy-2-bicyclo[2.2.1]heptanyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11574291 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 1-[(1R,2R,3R,4R,5S,6R)-3-hydroxy-5-(hydroxymethyl)-6-phenylmethoxy-2-bicyclo[2.2.1]heptanyl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2[C@H](O)[C@@H]3C[C@H]2[C@@H](OCc2ccccc2)[C@@H]3CO)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H24N2O5/c1-11-8-22(20(26)21-19(11)25)16-14-7-13(17(16)24)15(9-23)18(14)27-10-12-5-3-2-4-6-12/h2-6,8,13-18,23-24H,7,9-10H2,1H3,(H,21,25,26)/t13-,14-,15-,16-,17-,18-/m1/s1 |
| InChIKey | DPUVDXPFUIEAML-TYENPDHQSA-N |
| XLogP | 0.59 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |