C39H44N2O10 — CID 11204782
[(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-[[(2S,3R,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxymethyl]oxolan-3-yl] acetate (PubChem CID 11204782) has the molecular formula C39H44N2O10 and a molecular weight of 700.79 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-[[(2S,3R,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxymethyl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-[[(2S,3R,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxymethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 11204782 |
| Molecular Formula | C39H44N2O10 |
| Molecular Weight | 700.79 g/mol |
| Exact Mass | 700.30 |
| IUPAC Name | [(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-[[(2S,3R,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxymethyl]oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@@H]1CO[C@H]1O[C@@H](C)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C39H44N2O10/c1-25-20-41(39(44)40-37(25)43)33-19-31(50-27(3)42)32(51-33)24-48-38-36(47-23-30-17-11-6-12-18-30)35(46-22-29-15-9-5-10-16-29)34(26(2)49-38)45-21-28-13-7-4-8-14-28/h4-18,20,26,31-36,38H,19,21-24H2,1-3H3,(H,40,43,44)/t26-,31-,32+,33+,34-,35+,36+,38-/m0/s1 |
| InChIKey | FNRAJAAFXUERRJ-RKDZIXMPSA-N |
| XLogP | 4.58 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.79 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |