C21H27N2O8P — CID 71484265
[(2R,3S,5R)-2-[[hydroxy(3-phenylpropoxy)phosphanyl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate (PubChem CID 71484265) has the molecular formula C21H27N2O8P and a molecular weight of 466.43 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[[hydroxy(3-phenylpropoxy)phosphanyl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3S,5R)-2-[[hydroxy(3-phenylpropoxy)phosphanyl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 71484265 |
| Molecular Formula | C21H27N2O8P |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | [(2R,3S,5R)-2-[[hydroxy(3-phenylpropoxy)phosphanyl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@@H]1COP(O)OCCCc1ccccc1 |
| InChI | InChI=1S/C21H27N2O8P/c1-14-12-23(21(26)22-20(14)25)19-11-17(30-15(2)24)18(31-19)13-29-32(27)28-10-6-9-16-7-4-3-5-8-16/h3-5,7-8,12,17-19,27H,6,9-11,13H2,1-2H3,(H,22,25,26)/t17-,18+,19+,32?/m0/s1 |
| InChIKey | ZWRCLSROASNTIB-YSBSVDEMSA-N |
| XLogP | 1.95 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|