C21H27N3O5 — CID 51360174
3-[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-N-(3-phenylpropyl)propanamide (PubChem CID 51360174) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is 3-[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-N-(3-phenylpropyl)propanamide.
| Compound Name | 3-[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-N-(3-phenylpropyl)propanamide |
|---|---|
| PubChem CID | 51360174 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 3-[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-N-(3-phenylpropyl)propanamide |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](CCC(=O)NCCCc3ccccc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H27N3O5/c1-14-13-24(21(28)23-20(14)27)19-12-16(25)17(29-19)9-10-18(26)22-11-5-8-15-6-3-2-4-7-15/h2-4,6-7,13,16-17,19,25H,5,8-12H2,1H3,(H,22,26)(H,23,27,28)/t16-,17+,19+/m0/s1 |
| InChIKey | DRMOGTYGXJDMIS-YQVWRLOYSA-N |
| XLogP | 1.02 |
| TPSA | 113.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|