C20H25N5O10S2 — CID 11049983
[(3S,4R,5R)-4-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(methylsulfonyloxymethyl)-3-phenylmethoxyoxolan-2-yl]methyl methanesulfonate (PubChem CID 11049983) has the molecular formula C20H25N5O10S2 and a molecular weight of 559.58 g/mol. Its IUPAC name is [(3S,4R,5R)-4-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(methylsulfonyloxymethyl)-3-phenylmethoxyoxolan-2-yl]methyl methanesulfonate.
| Compound Name | [(3S,4R,5R)-4-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(methylsulfonyloxymethyl)-3-phenylmethoxyoxolan-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 11049983 |
| Molecular Formula | C20H25N5O10S2 |
| Molecular Weight | 559.58 g/mol |
| Exact Mass | 559.10 |
| IUPAC Name | [(3S,4R,5R)-4-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(methylsulfonyloxymethyl)-3-phenylmethoxyoxolan-2-yl]methyl methanesulfonate |
| SMILES | Cc1cn([C@@H]2OC(COS(C)(=O)=O)(COS(C)(=O)=O)[C@@H](OCc3ccccc3)[C@H]2N=[N+]=[N-])c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H25N5O10S2/c1-13-9-25(19(27)22-17(13)26)18-15(23-24-21)16(32-10-14-7-5-4-6-8-14)20(35-18,11-33-36(2,28)29)12-34-37(3,30)31/h4-9,15-16,18H,10-12H2,1-3H3,(H,22,26,27)/t15-,16+,18-/m1/s1 |
| InChIKey | MPGAOHVJPRLOOX-SOLBZPMBSA-N |
| XLogP | 0.33 |
| TPSA | 208.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.58 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|