C19H30N8O5 — CID 118258687
1-[(2R,5R)-3-azido-5-(azidomethyl)-4-butoxy-5-(butoxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 118258687) has the molecular formula C19H30N8O5 and a molecular weight of 450.50 g/mol. Its IUPAC name is 1-[(2R,5R)-3-azido-5-(azidomethyl)-4-butoxy-5-(butoxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-3-azido-5-(azidomethyl)-4-butoxy-5-(butoxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118258687 |
| Molecular Formula | C19H30N8O5 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 1-[(2R,5R)-3-azido-5-(azidomethyl)-4-butoxy-5-(butoxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CCCCOC[C@@]1(CN=[N+]=[N-])O[C@@H](n2cc(C)c(=O)[nH]c2=O)C(N=[N+]=[N-])C1OCCCC |
| InChI | InChI=1S/C19H30N8O5/c1-4-6-8-30-12-19(11-22-25-20)15(31-9-7-5-2)14(24-26-21)17(32-19)27-10-13(3)16(28)23-18(27)29/h10,14-15,17H,4-9,11-12H2,1-3H3,(H,23,28,29)/t14?,15?,17-,19-/m1/s1 |
| InChIKey | SLZSMDYIZPCHJF-IUSFWMAGSA-N |
| XLogP | 3.10 |
| TPSA | 180.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|