C21H31FN2O7 — CID 170523832
[(2R,3R,4S,5R)-4-butoxy-5-(butoxymethyl)-5-ethenyl-2-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate (PubChem CID 170523832) has the molecular formula C21H31FN2O7 and a molecular weight of 442.48 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-4-butoxy-5-(butoxymethyl)-5-ethenyl-2-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R)-4-butoxy-5-(butoxymethyl)-5-ethenyl-2-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 170523832 |
| Molecular Formula | C21H31FN2O7 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | [(2R,3R,4S,5R)-4-butoxy-5-(butoxymethyl)-5-ethenyl-2-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate |
| SMILES | C=C[C@]1(COCCCC)O[C@@H](n2cc(F)c(=O)[nH]c2=O)[C@H](OC(C)=O)[C@@H]1OCCCC |
| InChI | InChI=1S/C21H31FN2O7/c1-5-8-10-28-13-21(7-3)17(29-11-9-6-2)16(30-14(4)25)19(31-21)24-12-15(22)18(26)23-20(24)27/h7,12,16-17,19H,3,5-6,8-11,13H2,1-2,4H3,(H,23,26,27)/t16-,17+,19-,21-/m1/s1 |
| InChIKey | WLWFXENATRDISJ-SHJAMOMRSA-N |
| XLogP | 2.06 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|