C32H35N5O7 — CID 139320553
[5-ethenyl-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] acetate (PubChem CID 139320553) has the molecular formula C32H35N5O7 and a molecular weight of 601.66 g/mol. Its IUPAC name is [5-ethenyl-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] acetate.
| Compound Name | [5-ethenyl-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 139320553 |
| Molecular Formula | C32H35N5O7 |
| Molecular Weight | 601.66 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | [5-ethenyl-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] acetate |
| SMILES | C=CC1(COCc2ccccc2)OC(n2cnc3c(=O)[nH]c(NC(=O)C(C)C)nc32)C(OC(C)=O)C1OCc1ccccc1 |
| InChI | InChI=1S/C32H35N5O7/c1-5-32(18-41-16-22-12-8-6-9-13-22)26(42-17-23-14-10-7-11-15-23)25(43-21(4)38)30(44-32)37-19-33-24-27(37)34-31(36-29(24)40)35-28(39)20(2)3/h5-15,19-20,25-26,30H,1,16-18H2,2-4H3,(H2,34,35,36,39,40) |
| InChIKey | SQYPSAPDDVCPBZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.66 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|