C31H37N5O6Si — CID 136748419
N-[9-[(1R,3R,4R,5S)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-2,6-dioxabicyclo[3.2.0]heptan-3-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide (PubChem CID 136748419) has the molecular formula C31H37N5O6Si and a molecular weight of 603.75 g/mol. Its IUPAC name is N-[9-[(1R,3R,4R,5S)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-2,6-dioxabicyclo[3.2.0]heptan-3-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide.
| Compound Name | N-[9-[(1R,3R,4R,5S)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-2,6-dioxabicyclo[3.2.0]heptan-3-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 136748419 |
| Molecular Formula | C31H37N5O6Si |
| Molecular Weight | 603.75 g/mol |
| Exact Mass | 603.25 |
| IUPAC Name | N-[9-[(1R,3R,4R,5S)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-2,6-dioxabicyclo[3.2.0]heptan-3-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1nc2c(ncn2[C@@H]2O[C@@]3(CO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)CO[C@H]3[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C31H37N5O6Si/c1-19(2)26(38)34-29-33-25-22(27(39)35-29)32-18-36(25)28-23(37)24-31(42-28,16-40-24)17-41-43(30(3,4)5,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,18-19,23-24,28,37H,16-17H2,1-5H3,(H2,33,34,35,38,39)/t23-,24+,28-,31-/m1/s1 |
| InChIKey | QLXPDSBDRAXISO-GPRWGAKZSA-N |
| XLogP | 2.32 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.75 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|