C21H33N5O7Si — CID 166036312
2-[(2R,3S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl]oxyacetic acid (PubChem CID 166036312) has the molecular formula C21H33N5O7Si and a molecular weight of 495.61 g/mol. Its IUPAC name is 2-[(2R,3S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl]oxyacetic acid.
| Compound Name | 2-[(2R,3S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl]oxyacetic acid |
|---|---|
| PubChem CID | 166036312 |
| Molecular Formula | C21H33N5O7Si |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 2-[(2R,3S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl]oxyacetic acid |
| SMILES | CC(C)C(=O)Nc1nc2c(ncn2[C@@H]2OCC(O[Si](C)(C)C(C)(C)C)[C@@H]2OCC(=O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C21H33N5O7Si/c1-11(2)17(29)24-20-23-16-14(18(30)25-20)22-10-26(16)19-15(31-9-13(27)28)12(8-32-19)33-34(6,7)21(3,4)5/h10-12,15,19H,8-9H2,1-7H3,(H,27,28)(H2,23,24,25,29,30)/t12?,15-,19+/m0/s1 |
| InChIKey | RSTNUKWTQADBAB-VXVYQSRXSA-N |
| XLogP | 2.10 |
| TPSA | 157.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|