C32H37N5O7 — CID 136987831
[(2R,3R,4S,5R)-5-ethenyl-2-[2-(2-methylpropanoylamino)-6-oxo-7,8-dihydro-1H-purin-9-yl]-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] acetate (PubChem CID 136987831) has the molecular formula C32H37N5O7 and a molecular weight of 603.68 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5-ethenyl-2-[2-(2-methylpropanoylamino)-6-oxo-7,8-dihydro-1H-purin-9-yl]-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R)-5-ethenyl-2-[2-(2-methylpropanoylamino)-6-oxo-7,8-dihydro-1H-purin-9-yl]-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 136987831 |
| Molecular Formula | C32H37N5O7 |
| Molecular Weight | 603.68 g/mol |
| Exact Mass | 603.27 |
| IUPAC Name | [(2R,3R,4S,5R)-5-ethenyl-2-[2-(2-methylpropanoylamino)-6-oxo-7,8-dihydro-1H-purin-9-yl]-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] acetate |
| SMILES | C=C[C@]1(COCc2ccccc2)O[C@@H](N2CNc3c2nc(NC(=O)C(C)C)[nH]c3=O)[C@H](OC(C)=O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C32H37N5O7/c1-5-32(18-41-16-22-12-8-6-9-13-22)26(42-17-23-14-10-7-11-15-23)25(43-21(4)38)30(44-32)37-19-33-24-27(37)34-31(36-29(24)40)35-28(39)20(2)3/h5-15,20,25-26,30,33H,1,16-19H2,2-4H3,(H2,34,35,36,39,40)/t25-,26+,30-,32-/m1/s1 |
| InChIKey | QRAWABTVPSXBRE-LUYPNHPKSA-N |
| XLogP | 3.57 |
| TPSA | 144.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.68 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|