C35H45N5O7S — CID 118258686
9H-fluoren-9-ylmethyl N-[[(2R,4S,5R)-4-amino-3-butoxy-2-(butoxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methylcarbamothioyl]carbamate (PubChem CID 118258686) has the molecular formula C35H45N5O7S and a molecular weight of 679.84 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[[(2R,4S,5R)-4-amino-3-butoxy-2-(butoxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methylcarbamothioyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[[(2R,4S,5R)-4-amino-3-butoxy-2-(butoxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methylcarbamothioyl]carbamate |
|---|---|
| PubChem CID | 118258686 |
| Molecular Formula | C35H45N5O7S |
| Molecular Weight | 679.84 g/mol |
| Exact Mass | 679.30 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[[(2R,4S,5R)-4-amino-3-butoxy-2-(butoxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methylcarbamothioyl]carbamate |
| SMILES | CCCCOC[C@@]1(CNC(=S)NC(=O)OCC2c3ccccc3-c3ccccc32)O[C@@H](n2cc(C)c(=O)[nH]c2=O)[C@@H](N)C1OCCCC |
| InChI | InChI=1S/C35H45N5O7S/c1-4-6-16-44-21-35(29(45-17-7-5-2)28(36)31(47-35)40-18-22(3)30(41)38-33(40)42)20-37-32(48)39-34(43)46-19-27-25-14-10-8-12-23(25)24-13-9-11-15-26(24)27/h8-15,18,27-29,31H,4-7,16-17,19-21,36H2,1-3H3,(H,38,41,42)(H2,37,39,43,48)/t28-,29?,31+,35+/m0/s1 |
| InChIKey | DYCIBVJTGFDJSU-HUVIJTKQSA-N |
| XLogP | 3.86 |
| TPSA | 158.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.84 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|