C29H31N3O8 — CID 11478387
9H-fluoren-9-ylmethyl N-[3-[(1S,3R,4R,7S)-7-hydroxy-1-(hydroxymethyl)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dioxabicyclo[2.2.1]heptan-7-yl]propyl]carbamate (PubChem CID 11478387) has the molecular formula C29H31N3O8 and a molecular weight of 549.58 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-[(1S,3R,4R,7S)-7-hydroxy-1-(hydroxymethyl)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dioxabicyclo[2.2.1]heptan-7-yl]propyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-[(1S,3R,4R,7S)-7-hydroxy-1-(hydroxymethyl)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dioxabicyclo[2.2.1]heptan-7-yl]propyl]carbamate |
|---|---|
| PubChem CID | 11478387 |
| Molecular Formula | C29H31N3O8 |
| Molecular Weight | 549.58 g/mol |
| Exact Mass | 549.21 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-[(1S,3R,4R,7S)-7-hydroxy-1-(hydroxymethyl)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dioxabicyclo[2.2.1]heptan-7-yl]propyl]carbamate |
| SMILES | Cc1cn([C@@H]2O[C@@]3(CO)CO[C@@H]2[C@@]3(O)CCCNC(=O)OCC2c3ccccc3-c3ccccc32)c(=O)[nH]c1=O |
| InChI | InChI=1S/C29H31N3O8/c1-17-13-32(26(35)31-24(17)34)25-23-29(37,28(15-33,40-25)16-39-23)11-6-12-30-27(36)38-14-22-20-9-4-2-7-18(20)19-8-3-5-10-21(19)22/h2-5,7-10,13,22-23,25,33,37H,6,11-12,14-16H2,1H3,(H,30,36)(H,31,34,35)/t23-,25+,28-,29-/m0/s1 |
| InChIKey | LKHRNEWLJUMEIX-MDPQSHMSSA-N |
| XLogP | 1.55 |
| TPSA | 152.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.58 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|