C22H23N5O9 — CID 175676965
[(2R,3S,4R,5R)-3,4-diacetyloxy-2-(azidomethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate (PubChem CID 175676965) has the molecular formula C22H23N5O9 and a molecular weight of 501.45 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-diacetyloxy-2-(azidomethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4R,5R)-3,4-diacetyloxy-2-(azidomethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 175676965 |
| Molecular Formula | C22H23N5O9 |
| Molecular Weight | 501.45 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-diacetyloxy-2-(azidomethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate |
| SMILES | CC(=O)O[C@H]1[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@](CN=[N+]=[N-])(COC(=O)c2ccccc2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C22H23N5O9/c1-12-9-27(21(32)25-18(12)30)19-16(34-13(2)28)17(35-14(3)29)22(36-19,10-24-26-23)11-33-20(31)15-7-5-4-6-8-15/h4-9,16-17,19H,10-11H2,1-3H3,(H,25,30,32)/t16-,17+,19-,22-/m1/s1 |
| InChIKey | JTAFWDUOUAHYRN-ZRAXVTTISA-N |
| XLogP | 1.14 |
| TPSA | 191.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.45 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|