C32H40N2O8Si — CID 10817500
diethyl 2-[(2R,3S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]propanedioate (PubChem CID 10817500) has the molecular formula C32H40N2O8Si and a molecular weight of 608.76 g/mol. Its IUPAC name is diethyl 2-[(2R,3S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]propanedioate.
| Compound Name | diethyl 2-[(2R,3S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]propanedioate |
|---|---|
| PubChem CID | 10817500 |
| Molecular Formula | C32H40N2O8Si |
| Molecular Weight | 608.76 g/mol |
| Exact Mass | 608.26 |
| IUPAC Name | diethyl 2-[(2R,3S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H]1C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C32H40N2O8Si/c1-6-39-29(36)27(30(37)40-7-2)25-20-22(42-28(25)34-19-18-26(35)33-31(34)38)21-41-43(32(3,4)5,23-14-10-8-11-15-23)24-16-12-9-13-17-24/h8-19,22,25,27-28H,6-7,20-21H2,1-5H3,(H,33,35,38)/t22-,25-,28+/m0/s1 |
| InChIKey | QBUMBCDPNVJFLU-NAYZPBBASA-N |
| XLogP | 2.76 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.76 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|