C32H39BrN2O8Si — CID 146032371
diethyl 2-[(2R,3R,5S)-2-(5-bromo-2,4-dioxopyrimidin-1-yl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-yl]propanedioate (PubChem CID 146032371) has the molecular formula C32H39BrN2O8Si and a molecular weight of 687.66 g/mol. Its IUPAC name is diethyl 2-[(2R,3R,5S)-2-(5-bromo-2,4-dioxopyrimidin-1-yl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-yl]propanedioate.
| Compound Name | diethyl 2-[(2R,3R,5S)-2-(5-bromo-2,4-dioxopyrimidin-1-yl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-yl]propanedioate |
|---|---|
| PubChem CID | 146032371 |
| Molecular Formula | C32H39BrN2O8Si |
| Molecular Weight | 687.66 g/mol |
| Exact Mass | 686.17 |
| IUPAC Name | diethyl 2-[(2R,3R,5S)-2-(5-bromo-2,4-dioxopyrimidin-1-yl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@H]1C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@H]1n1cc(Br)c(=O)[nH]c1=O |
| InChI | InChI=1S/C32H39BrN2O8Si/c1-6-40-29(37)26(30(38)41-7-2)24-18-21(43-28(24)35-19-25(33)27(36)34-31(35)39)20-42-44(32(3,4)5,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-17,19,21,24,26,28H,6-7,18,20H2,1-5H3,(H,34,36,39)/t21-,24+,28+/m0/s1 |
| InChIKey | ROBGEQLJMRTHKQ-FFCVWOAGSA-N |
| XLogP | 3.52 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.66 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|