C29H38FN3O5Si — CID 21040862
1-[(2R,3S,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-4-(4-hydroxybutylamino)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 21040862) has the molecular formula C29H38FN3O5Si and a molecular weight of 555.72 g/mol. Its IUPAC name is 1-[(2R,3S,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-4-(4-hydroxybutylamino)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-4-(4-hydroxybutylamino)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 21040862 |
| Molecular Formula | C29H38FN3O5Si |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | 1-[(2R,3S,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-4-(4-hydroxybutylamino)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H](F)[C@@H]1NCCCCO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H38FN3O5Si/c1-29(2,3)39(21-12-6-4-7-13-21,22-14-8-5-9-15-22)37-20-23-26(31-17-10-11-19-34)25(30)27(38-23)33-18-16-24(35)32-28(33)36/h4-9,12-16,18,23,25-27,31,34H,10-11,17,19-20H2,1-3H3,(H,32,35,36)/t23-,25+,26-,27-/m1/s1 |
| InChIKey | NIVHVZWSEAHDRB-INVSNAKLSA-N |
| XLogP | 2.08 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|