C28H34N2O6Si — CID 15277628
1-[(2R,3R,4S,5R)-3-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-5-(hydroxymethyl)-4-prop-2-enyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 15277628) has the molecular formula C28H34N2O6Si and a molecular weight of 522.67 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-5-(hydroxymethyl)-4-prop-2-enyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-3-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-5-(hydroxymethyl)-4-prop-2-enyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 15277628 |
| Molecular Formula | C28H34N2O6Si |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-5-(hydroxymethyl)-4-prop-2-enyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C=CC[C@]1(O)[C@@H](CO)O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H34N2O6Si/c1-5-17-28(34)22(19-31)35-25(30-18-16-23(32)29-26(30)33)24(28)36-37(27(2,3)4,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h5-16,18,22,24-25,31,34H,1,17,19H2,2-4H3,(H,29,32,33)/t22-,24+,25-,28+/m1/s1 |
| InChIKey | GMWFWWOERILJDQ-YNNKJJCMSA-N |
| XLogP | 1.68 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|