C12H14N2O7 — CID 88658414
3-[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-2-(hydroxymethyl)oxolan-3-yl]prop-2-enal (PubChem CID 88658414) has the molecular formula C12H14N2O7 and a molecular weight of 298.25 g/mol. Its IUPAC name is 3-[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-2-(hydroxymethyl)oxolan-3-yl]prop-2-enal.
| Compound Name | 3-[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-2-(hydroxymethyl)oxolan-3-yl]prop-2-enal |
|---|---|
| PubChem CID | 88658414 |
| Molecular Formula | C12H14N2O7 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 3-[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-2-(hydroxymethyl)oxolan-3-yl]prop-2-enal |
| SMILES | O=CC=C[C@]1(O)[C@@H](CO)O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H]1O |
| InChI | InChI=1S/C12H14N2O7/c15-5-1-3-12(20)7(6-16)21-10(9(12)18)14-4-2-8(17)13-11(14)19/h1-5,7,9-10,16,18,20H,6H2,(H,13,17,19)/t7-,9+,10-,12+/m1/s1 |
| InChIKey | HAIVQVONLCEHSP-LZDMXVKQSA-N |
| XLogP | -2.73 |
| TPSA | 141.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|