C11H16N2O5 — CID 126578655
1-[(2R,3R,4R,5S)-4,5-bis(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 126578655) has the molecular formula C11H16N2O5 and a molecular weight of 256.26 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5S)-4,5-bis(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5S)-4,5-bis(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 126578655 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 1-[(2R,3R,4R,5S)-4,5-bis(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C[C@@H]1[C@H](CO)[C@@H](CO)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C11H16N2O5/c1-6-7(4-14)8(5-15)18-10(6)13-3-2-9(16)12-11(13)17/h2-3,6-8,10,14-15H,4-5H2,1H3,(H,12,16,17)/t6-,7+,8-,10-/m1/s1 |
| InChIKey | ZAVIYFAIIROGRK-IBCQBUCCSA-N |
| XLogP | -1.33 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |