C11H12N2O6 — CID 140973491
1-[(3R,4S,5R)-4-(2-deuterioethynyl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 140973491) has the molecular formula C11H12N2O6 and a molecular weight of 269.23 g/mol. Its IUPAC name is 1-[(3R,4S,5R)-4-(2-deuterioethynyl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(3R,4S,5R)-4-(2-deuterioethynyl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 140973491 |
| Molecular Formula | C11H12N2O6 |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 1-[(3R,4S,5R)-4-(2-deuterioethynyl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | [2H]C#C[C@@]1(O)[C@@H](CO)OC(n2ccc(=O)[nH]c2=O)[C@@H]1O |
| InChI | InChI=1S/C11H12N2O6/c1-2-11(18)6(5-14)19-9(8(11)16)13-4-3-7(15)12-10(13)17/h1,3-4,6,8-9,14,16,18H,5H2,(H,12,15,17)/t6-,8+,9?,11-/m1/s1/i1D |
| InChIKey | KNGMLOFYXFWJLZ-FHHRFVSVSA-N |
| XLogP | -2.85 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|