C10H13BrN2O7S — CID 67636389
1-[(2R,4S,5R)-3-bromo-4-hydroxy-5-(hydroxymethyl)-4-methylsulfonyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 67636389) has the molecular formula C10H13BrN2O7S and a molecular weight of 385.19 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-3-bromo-4-hydroxy-5-(hydroxymethyl)-4-methylsulfonyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-3-bromo-4-hydroxy-5-(hydroxymethyl)-4-methylsulfonyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67636389 |
| Molecular Formula | C10H13BrN2O7S |
| Molecular Weight | 385.19 g/mol |
| Exact Mass | 383.96 |
| IUPAC Name | 1-[(2R,4S,5R)-3-bromo-4-hydroxy-5-(hydroxymethyl)-4-methylsulfonyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CS(=O)(=O)[C@]1(O)C(Br)[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1CO |
| InChI | InChI=1S/C10H13BrN2O7S/c1-21(18,19)10(17)5(4-14)20-8(7(10)11)13-3-2-6(15)12-9(13)16/h2-3,5,7-8,14,17H,4H2,1H3,(H,12,15,16)/t5-,7?,8-,10+/m1/s1 |
| InChIKey | BVFOOCPWXWONAL-KQMUTXFVSA-N |
| XLogP | -2.08 |
| TPSA | 138.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.19 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|