C18H30N2O5Si — CID 11280520
1-[(2R,3R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-3-prop-2-enyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 11280520) has the molecular formula C18H30N2O5Si and a molecular weight of 382.53 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-3-prop-2-enyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-3-prop-2-enyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11280520 |
| Molecular Formula | C18H30N2O5Si |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-3-prop-2-enyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C=CC[C@@H]1[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C18H30N2O5Si/c1-7-8-12-15(22)13(11-24-26(5,6)18(2,3)4)25-16(12)20-10-9-14(21)19-17(20)23/h7,9-10,12-13,15-16,22H,1,8,11H2,2-6H3,(H,19,21,23)/t12-,13-,15+,16-/m1/s1 |
| InChIKey | UKGUHMUMJFEPSI-LUYZLQTOSA-N |
| XLogP | 2.01 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|