C15H22N2O6 — CID 58969828
1-[4-hydroxy-5-(methoxymethyl)-3-pent-4-enoxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 58969828) has the molecular formula C15H22N2O6 and a molecular weight of 326.35 g/mol. Its IUPAC name is 1-[4-hydroxy-5-(methoxymethyl)-3-pent-4-enoxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[4-hydroxy-5-(methoxymethyl)-3-pent-4-enoxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58969828 |
| Molecular Formula | C15H22N2O6 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 1-[4-hydroxy-5-(methoxymethyl)-3-pent-4-enoxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C=CCCCOC1C(O)C(COC)OC1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C15H22N2O6/c1-3-4-5-8-22-13-12(19)10(9-21-2)23-14(13)17-7-6-11(18)16-15(17)20/h3,6-7,10,12-14,19H,1,4-5,8-9H2,2H3,(H,16,18,20) |
| InChIKey | FQXFLSGRLCCODT-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|