C12H17N2O9P — CID 22875589
[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-prop-2-enoxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 22875589) has the molecular formula C12H17N2O9P and a molecular weight of 364.25 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-prop-2-enoxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-prop-2-enoxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 22875589 |
| Molecular Formula | C12H17N2O9P |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-prop-2-enoxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | C=CCO[C@@H]1[C@H](O)[C@@H](COP(=O)(O)O)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C12H17N2O9P/c1-2-5-21-10-9(16)7(6-22-24(18,19)20)23-11(10)14-4-3-8(15)13-12(14)17/h2-4,7,9-11,16H,1,5-6H2,(H,13,15,17)(H2,18,19,20)/t7-,9-,10-,11-/m1/s1 |
| InChIKey | CYCHUZOQVOMLCK-QCNRFFRDSA-N |
| XLogP | -1.52 |
| TPSA | 160.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|