C33H35N3O7Si — CID 134930197
[(2R,3S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] N-benzoylcarbamate (PubChem CID 134930197) has the molecular formula C33H35N3O7Si and a molecular weight of 613.74 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] N-benzoylcarbamate.
| Compound Name | [(2R,3S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] N-benzoylcarbamate |
|---|---|
| PubChem CID | 134930197 |
| Molecular Formula | C33H35N3O7Si |
| Molecular Weight | 613.74 g/mol |
| Exact Mass | 613.22 |
| IUPAC Name | [(2R,3S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] N-benzoylcarbamate |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)C[C@@H]1OC(=O)NC(=O)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H35N3O7Si/c1-33(2,3)44(24-15-9-5-10-16-24,25-17-11-6-12-18-25)41-22-27-26(21-29(42-27)36-20-19-28(37)34-31(36)39)43-32(40)35-30(38)23-13-7-4-8-14-23/h4-20,26-27,29H,21-22H2,1-3H3,(H,34,37,39)(H,35,38,40)/t26-,27+,29+/m0/s1 |
| InChIKey | OEJLPMDCZIZSIL-YIKNKFAXSA-N |
| XLogP | 3.34 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.74 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|