C36H39NO4S2Si — CID 11135991
[(2R,3S)-5-benzylsulfanyl-2-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-3-yl] N-benzoylcarbamate (PubChem CID 11135991) has the molecular formula C36H39NO4S2Si and a molecular weight of 641.93 g/mol. Its IUPAC name is [(2R,3S)-5-benzylsulfanyl-2-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-3-yl] N-benzoylcarbamate.
| Compound Name | [(2R,3S)-5-benzylsulfanyl-2-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-3-yl] N-benzoylcarbamate |
|---|---|
| PubChem CID | 11135991 |
| Molecular Formula | C36H39NO4S2Si |
| Molecular Weight | 641.93 g/mol |
| Exact Mass | 641.21 |
| IUPAC Name | [(2R,3S)-5-benzylsulfanyl-2-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-3-yl] N-benzoylcarbamate |
| SMILES | CC(C)(C)[Si](OC[C@H]1SC(SCc2ccccc2)C[C@@H]1OC(=O)NC(=O)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H39NO4S2Si/c1-36(2,3)44(29-20-12-6-13-21-29,30-22-14-7-15-23-30)40-25-32-31(24-33(43-32)42-26-27-16-8-4-9-17-27)41-35(39)37-34(38)28-18-10-5-11-19-28/h4-23,31-33H,24-26H2,1-3H3,(H,37,38,39)/t31-,32+,33?/m0/s1 |
| InChIKey | VGHGSRQSPWMTNY-XIWRNSNHSA-N |
| XLogP | 7.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.93 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|