C27H26O4S2 — CID 10005304
[(2S,3R)-2-(benzoyloxymethyl)-5-benzylsulfanylthiolan-3-yl]methyl benzoate (PubChem CID 10005304) has the molecular formula C27H26O4S2 and a molecular weight of 478.64 g/mol. Its IUPAC name is [(2S,3R)-2-(benzoyloxymethyl)-5-benzylsulfanylthiolan-3-yl]methyl benzoate.
| Compound Name | [(2S,3R)-2-(benzoyloxymethyl)-5-benzylsulfanylthiolan-3-yl]methyl benzoate |
|---|---|
| PubChem CID | 10005304 |
| Molecular Formula | C27H26O4S2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | [(2S,3R)-2-(benzoyloxymethyl)-5-benzylsulfanylthiolan-3-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1CC(SCc2ccccc2)S[C@@H]1COC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H26O4S2/c28-26(21-12-6-2-7-13-21)30-17-23-16-25(32-19-20-10-4-1-5-11-20)33-24(23)18-31-27(29)22-14-8-3-9-15-22/h1-15,23-25H,16-19H2/t23-,24-,25?/m1/s1 |
| InChIKey | ZTLOCMINZCDNNS-AEAWWFNXSA-N |
| XLogP | 6.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |