C26H28O2S2 — CID 11293510
(2S,3S)-5-benzylsulfanyl-3-phenylmethoxy-2-(phenylmethoxymethyl)thiolane (PubChem CID 11293510) has the molecular formula C26H28O2S2 and a molecular weight of 436.64 g/mol. Its IUPAC name is (2S,3S)-5-benzylsulfanyl-3-phenylmethoxy-2-(phenylmethoxymethyl)thiolane.
| Compound Name | (2S,3S)-5-benzylsulfanyl-3-phenylmethoxy-2-(phenylmethoxymethyl)thiolane |
|---|---|
| PubChem CID | 11293510 |
| Molecular Formula | C26H28O2S2 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | (2S,3S)-5-benzylsulfanyl-3-phenylmethoxy-2-(phenylmethoxymethyl)thiolane |
| SMILES | c1ccc(COC[C@@H]2SC(SCc3ccccc3)C[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H28O2S2/c1-4-10-21(11-5-1)17-27-19-25-24(28-18-22-12-6-2-7-13-22)16-26(30-25)29-20-23-14-8-3-9-15-23/h1-15,24-26H,16-20H2/t24-,25-,26?/m0/s1 |
| InChIKey | AJOOJPRYRSQRLM-NPGWBMRXSA-N |
| XLogP | 6.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |