C17H17N2O8P — CID 70899830
[(E)-2-[(2S,4R,5R)-4-benzoyloxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]ethenyl]phosphonic acid (PubChem CID 70899830) has the molecular formula C17H17N2O8P and a molecular weight of 408.30 g/mol. Its IUPAC name is [(E)-2-[(2S,4R,5R)-4-benzoyloxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]ethenyl]phosphonic acid.
| Compound Name | [(E)-2-[(2S,4R,5R)-4-benzoyloxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]ethenyl]phosphonic acid |
|---|---|
| PubChem CID | 70899830 |
| Molecular Formula | C17H17N2O8P |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | [(E)-2-[(2S,4R,5R)-4-benzoyloxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]ethenyl]phosphonic acid |
| SMILES | O=C(O[C@@H]1C[C@@H](/C=C/P(=O)(O)O)O[C@H]1n1ccc(=O)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C17H17N2O8P/c20-14-6-8-19(17(22)18-14)15-13(10-12(26-15)7-9-28(23,24)25)27-16(21)11-4-2-1-3-5-11/h1-9,12-13,15H,10H2,(H,18,20,22)(H2,23,24,25)/b9-7+/t12-,13-,15-/m1/s1 |
| InChIKey | ZCPIIULHSWJGMO-BSUNCPLPSA-N |
| XLogP | 0.74 |
| TPSA | 147.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|