C9H11N2Na2O7P — CID 11427650
disodium;1-[(2R,4R)-4-(phosphonatomethoxy)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 11427650) has the molecular formula C9H11N2Na2O7P and a molecular weight of 336.15 g/mol. Its IUPAC name is disodium;1-[(2R,4R)-4-(phosphonatomethoxy)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | disodium;1-[(2R,4R)-4-(phosphonatomethoxy)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11427650 |
| Molecular Formula | C9H11N2Na2O7P |
| Molecular Weight | 336.15 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | disodium;1-[(2R,4R)-4-(phosphonatomethoxy)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@H]2C[C@@H](OCP(=O)([O-])[O-])CO2)c(=O)[nH]1.[Na+].[Na+] |
| InChI | InChI=1S/C9H13N2O7P.2Na/c12-7-1-2-11(9(13)10-7)8-3-6(4-17-8)18-5-19(14,15)16;;/h1-2,6,8H,3-5H2,(H,10,12,13)(H2,14,15,16);;/q;2*+1/p-2/t6-,8-;;/m1../s1 |
| InChIKey | QTEDXNBKDYIPCU-QGTMZHJHSA-L |
| XLogP | -8.28 |
| TPSA | 136.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.15 |
| LogP ≤ 5 | -8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|